C10H21BF9NO — CID 157061128
diethyl-(2-methoxyethyl)-methylazanium;1,1,1,2,2-pentafluoroethane;tetrafluoroborate (PubChem CID 157061128) has the molecular formula C10H21BF9NO and a molecular weight of 353.08 g/mol. Its IUPAC name is diethyl-(2-methoxyethyl)-methylazanium;1,1,1,2,2-pentafluoroethane;tetrafluoroborate.
| Compound Name | diethyl-(2-methoxyethyl)-methylazanium;1,1,1,2,2-pentafluoroethane;tetrafluoroborate |
|---|---|
| PubChem CID | 157061128 |
| Molecular Formula | C10H21BF9NO |
| Molecular Weight | 353.08 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | diethyl-(2-methoxyethyl)-methylazanium;1,1,1,2,2-pentafluoroethane;tetrafluoroborate |
| SMILES | CC[N+](C)(CC)CCOC.FC(F)C(F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C8H20NO.C2HF5.BF4/c1-5-9(3,6-2)7-8-10-4;3-1(4)2(5,6)7;2-1(3,4)5/h5-8H2,1-4H3;1H;/q+1;;-1 |
| InChIKey | ABIPORWQFUOAKA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.08 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|