C8H16Cl2O3Si — CID 173033683
[1,1-dichloro-5-(oxiran-2-ylmethoxy)pentan-2-yl]oxysilane (PubChem CID 173033683) has the molecular formula C8H16Cl2O3Si and a molecular weight of 259.20 g/mol. Its IUPAC name is [1,1-dichloro-5-(oxiran-2-ylmethoxy)pentan-2-yl]oxysilane.
| Compound Name | [1,1-dichloro-5-(oxiran-2-ylmethoxy)pentan-2-yl]oxysilane |
|---|---|
| PubChem CID | 173033683 |
| Molecular Formula | C8H16Cl2O3Si |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | [1,1-dichloro-5-(oxiran-2-ylmethoxy)pentan-2-yl]oxysilane |
| SMILES | [SiH3]OC(CCCOCC1CO1)C(Cl)Cl |
| InChI | InChI=1S/C8H16Cl2O3Si/c9-8(10)7(13-14)2-1-3-11-4-6-5-12-6/h6-8H,1-5H2,14H3 |
| InChIKey | LJAQKNYEGZAKRX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|