C10H4F6I2O4-2 — CID 173034917
[4-(2,2,2-trifluoroacetyl)oxyiodanuidylphenyl]iodanuidyl 2,2,2-trifluoroacetate (PubChem CID 173034917) has the molecular formula C10H4F6I2O4-2 and a molecular weight of 555.93 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroacetyl)oxyiodanuidylphenyl]iodanuidyl 2,2,2-trifluoroacetate.
| Compound Name | [4-(2,2,2-trifluoroacetyl)oxyiodanuidylphenyl]iodanuidyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173034917 |
| Molecular Formula | C10H4F6I2O4-2 |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 555.81 |
| IUPAC Name | [4-(2,2,2-trifluoroacetyl)oxyiodanuidylphenyl]iodanuidyl 2,2,2-trifluoroacetate |
| SMILES | O=C(O[I-]c1ccc([I-]OC(=O)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H4F6I2O4/c11-9(12,13)7(19)21-17-5-1-2-6(4-3-5)18-22-8(20)10(14,15)16/h1-4H/q-2 |
| InChIKey | PFGKWSUHASKSRF-UHFFFAOYSA-N |
| XLogP | -3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|