C12H12Cl2MgO5 — CID 173046400
magnesium;4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid;hydride (PubChem CID 173046400) has the molecular formula C12H12Cl2MgO5 and a molecular weight of 331.43 g/mol. Its IUPAC name is magnesium;4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid;hydride.
| Compound Name | magnesium;4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid;hydride |
|---|---|
| PubChem CID | 173046400 |
| Molecular Formula | C12H12Cl2MgO5 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | magnesium;4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid;hydride |
| SMILES | CC(=CC(Oc1ccc(Cl)cc1Cl)C(=O)O)C(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C12H10Cl2O5.Mg.2H/c1-6(11(15)16)4-10(12(17)18)19-9-3-2-7(13)5-8(9)14;;;/h2-5,10H,1H3,(H,15,16)(H,17,18);;;/q;+2;2*-1 |
| InChIKey | JIFUNMKPKCKILE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|