C12H10Cl2O5 — CID 67098274
4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid (PubChem CID 67098274) has the molecular formula C12H10Cl2O5 and a molecular weight of 305.11 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid.
| Compound Name | 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid |
|---|---|
| PubChem CID | 67098274 |
| Molecular Formula | C12H10Cl2O5 |
| Molecular Weight | 305.11 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid |
| SMILES | CC(=CC(Oc1ccc(Cl)cc1Cl)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H10Cl2O5/c1-6(11(15)16)4-10(12(17)18)19-9-3-2-7(13)5-8(9)14/h2-5,10H,1H3,(H,15,16)(H,17,18) |
| InChIKey | WPIGJVZHJOLNEP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|