4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid

C12H10Cl2O5 — CID 67098274

IUPAC4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid
SMILESCC(=CC(Oc1ccc(Cl)cc1Cl)C(=O)O)C(=O)O
InChIInChI=1S/C12H10Cl2O5/c1-6(11(15)16)4-10(12(17)18)19-9-3-2-7(13)5-8(9)14/h2-5,10H,1H3,(H,15,16)(H,17,18)
InChIKeyWPIGJVZHJOLNEP-UHFFFAOYSA-N
MW305.11 g/mol
LogP2.86
Rot. Bonds5

About 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid

4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid (PubChem CID 67098274) has the molecular formula C12H10Cl2O5 and a molecular weight of 305.11 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid.

Molecular Properties

Compound Name4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid
PubChem CID67098274
Molecular FormulaC12H10Cl2O5
Molecular Weight305.11 g/mol
Exact Mass303.99
IUPAC Name4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid
SMILESCC(=CC(Oc1ccc(Cl)cc1Cl)C(=O)O)C(=O)O
InChIInChI=1S/C12H10Cl2O5/c1-6(11(15)16)4-10(12(17)18)19-9-3-2-7(13)5-8(9)14/h2-5,10H,1H3,(H,15,16)(H,17,18)
InChIKeyWPIGJVZHJOLNEP-UHFFFAOYSA-N
XLogP2.86
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.11
LogP ≤ 52.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid?
The IUPAC name of 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid (CID 67098274) is 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid.
What is the SMILES notation for 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid?
The canonical SMILES for 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid is CC(=CC(Oc1ccc(Cl)cc1Cl)C(=O)O)C(=O)O.
What is the InChIKey of 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid?
The InChIKey is WPIGJVZHJOLNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2O5/c1-6(11(15)16)4-10(12(17)18)19-9-3-2-7(13)5-8(9)14/h2-5,10H,1H3,(H,15,16)(H,17,18).
What are the key properties of 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid?
4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid has a molecular weight of 305.11 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenoxy)-2-methylpent-2-enedioic acid is sourced from PubChem (CID 67098274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).