C17H20FO3P — CID 173048875
fluoro-[2-(4-methylphenyl)-4-(2-methylpropyl)phenoxy]phosphinic acid (PubChem CID 173048875) has the molecular formula C17H20FO3P and a molecular weight of 322.32 g/mol. Its IUPAC name is fluoro-[2-(4-methylphenyl)-4-(2-methylpropyl)phenoxy]phosphinic acid.
| Compound Name | fluoro-[2-(4-methylphenyl)-4-(2-methylpropyl)phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 173048875 |
| Molecular Formula | C17H20FO3P |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | fluoro-[2-(4-methylphenyl)-4-(2-methylpropyl)phenoxy]phosphinic acid |
| SMILES | Cc1ccc(-c2cc(CC(C)C)ccc2OP(=O)(O)F)cc1 |
| InChI | InChI=1S/C17H20FO3P/c1-12(2)10-14-6-9-17(21-22(18,19)20)16(11-14)15-7-4-13(3)5-8-15/h4-9,11-12H,10H2,1-3H3,(H,19,20) |
| InChIKey | BHBFYBDSAUENCQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|