C12H17NO — CID 173049166
2-methoxy-N,N-dimethyl-3-prop-1-en-2-ylaniline (PubChem CID 173049166) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-3-prop-1-en-2-ylaniline.
| Compound Name | 2-methoxy-N,N-dimethyl-3-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 173049166 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-3-prop-1-en-2-ylaniline |
| SMILES | C=C(C)c1cccc(N(C)C)c1OC |
| InChI | InChI=1S/C12H17NO/c1-9(2)10-7-6-8-11(13(3)4)12(10)14-5/h6-8H,1H2,2-5H3 |
| InChIKey | GZEZYZIJMRSCQX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |