C22H48O9Si — CID 173050272
2-[2-[2-[2-[2-[2-[2-(3-methyl-2-propan-2-yl-2-silyloxybutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 173050272) has the molecular formula C22H48O9Si and a molecular weight of 484.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(3-methyl-2-propan-2-yl-2-silyloxybutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(3-methyl-2-propan-2-yl-2-silyloxybutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 173050272 |
| Molecular Formula | C22H48O9Si |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(3-methyl-2-propan-2-yl-2-silyloxybutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(C)C(COCCOCCOCCOCCOCCOCCOCCO)(O[SiH3])C(C)C |
| InChI | InChI=1S/C22H48O9Si/c1-20(2)22(31-32,21(3)4)19-30-18-17-29-16-15-28-14-13-27-12-11-26-10-9-25-8-7-24-6-5-23/h20-21,23H,5-19H2,1-4,32H3 |
| InChIKey | SYMCIKPYGFREKN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|