C14H12Cl2NNaO2 — CID 173055084
sodium;[2-(2,6-dichloroanilino)phenyl] acetate;hydride (PubChem CID 173055084) has the molecular formula C14H12Cl2NNaO2 and a molecular weight of 320.15 g/mol. Its IUPAC name is sodium;[2-(2,6-dichloroanilino)phenyl] acetate;hydride.
| Compound Name | sodium;[2-(2,6-dichloroanilino)phenyl] acetate;hydride |
|---|---|
| PubChem CID | 173055084 |
| Molecular Formula | C14H12Cl2NNaO2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | sodium;[2-(2,6-dichloroanilino)phenyl] acetate;hydride |
| SMILES | CC(=O)Oc1ccccc1Nc1c(Cl)cccc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C14H11Cl2NO2.Na.H/c1-9(18)19-13-8-3-2-7-12(13)17-14-10(15)5-4-6-11(14)16;;/h2-8,17H,1H3;;/q;+1;-1 |
| InChIKey | JEUFJRABSRHCSR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|