C21H24O2 — CID 173061157
1-(3-hydroxy-3H-inden-1-yl)dodeca-2,4,6-trien-1-one (PubChem CID 173061157) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-(3-hydroxy-3H-inden-1-yl)dodeca-2,4,6-trien-1-one.
| Compound Name | 1-(3-hydroxy-3H-inden-1-yl)dodeca-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 173061157 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(3-hydroxy-3H-inden-1-yl)dodeca-2,4,6-trien-1-one |
| SMILES | CCCCCC=CC=CC=CC(=O)C1=CC(O)c2ccccc21 |
| InChI | InChI=1S/C21H24O2/c1-2-3-4-5-6-7-8-9-10-15-20(22)19-16-21(23)18-14-12-11-13-17(18)19/h6-16,21,23H,2-5H2,1H3 |
| InChIKey | FWQKYIRVFGDPIR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|