C14H24N2O3S2 — CID 173069030
tert-butyl-[[(1R)-1-[5-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazol-2-yl]ethyl]amino]-oxidosulfanium (PubChem CID 173069030) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl-[[(1R)-1-[5-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazol-2-yl]ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1R)-1-[5-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazol-2-yl]ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 173069030 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | tert-butyl-[[(1R)-1-[5-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-thiazol-2-yl]ethyl]amino]-oxidosulfanium |
| SMILES | C[C@@H](N[S+]([O-])C(C)(C)C)c1ncc(C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C14H24N2O3S2/c1-9(16-21(18)14(5,6)7)11-15-8-10(20-11)12(17)19-13(2,3)4/h8-9,16H,1-7H3/t9-,21?/m1/s1 |
| InChIKey | PNQHNBWWGFJLPG-AVBQWDGQSA-N |
| XLogP | 3.21 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|