C20H24ClN3O4S — CID 173069372
[2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate (PubChem CID 173069372) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is [2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate.
| Compound Name | [2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate |
|---|---|
| PubChem CID | 173069372 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] N-tert-butyl-N-piperidin-3-ylcarbamate |
| SMILES | CC(C)(C)N(C(=O)Oc1c(Cl)cccc1C=C1SC(=O)NC1=O)C1CCCNC1 |
| InChI | InChI=1S/C20H24ClN3O4S/c1-20(2,3)24(13-7-5-9-22-11-13)19(27)28-16-12(6-4-8-14(16)21)10-15-17(25)23-18(26)29-15/h4,6,8,10,13,22H,5,7,9,11H2,1-3H3,(H,23,25,26) |
| InChIKey | UFHRMIHVYIEUFQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|