C8H16O5Si — CID 173073157
2-dimethoxysilyloxyethyl 2-methylprop-2-enoate (PubChem CID 173073157) has the molecular formula C8H16O5Si and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-dimethoxysilyloxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-dimethoxysilyloxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173073157 |
| Molecular Formula | C8H16O5Si |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-dimethoxysilyloxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO[SiH](OC)OC |
| InChI | InChI=1S/C8H16O5Si/c1-7(2)8(9)12-5-6-13-14(10-3)11-4/h14H,1,5-6H2,2-4H3 |
| InChIKey | DTLCCUNOOUJVBF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|