C21H20O6 — CID 173073323
1,2,6,7-tetradeuterio-5-hydroxy-1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta-1,4,6-trien-3-one (PubChem CID 173073323) has the molecular formula C21H20O6 and a molecular weight of 378.45 g/mol. Its IUPAC name is 1,2,6,7-tetradeuterio-5-hydroxy-1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta-1,4,6-trien-3-one.
| Compound Name | 1,2,6,7-tetradeuterio-5-hydroxy-1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 173073323 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1,2,6,7-tetradeuterio-5-hydroxy-1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta-1,4,6-trien-3-one |
| SMILES | [2H]C(C(=O)C=C(O)C([2H])=C([2H])c1ccc(O)c(OC([2H])([2H])[2H])c1)=C([2H])c1ccc(O)c(OC([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-13,22,24-25H,1-2H3/i1D3,2D3,3D,4D,7D,8D |
| InChIKey | ZIUSSTSXXLLKKK-GVQRMYOSSA-N |
| XLogP | 3.85 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|