C22H29IO4Si — CID 173074815
[(3S,4R,5R)-4-iodo-2-methoxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-diphenylsilane (PubChem CID 173074815) has the molecular formula C22H29IO4Si and a molecular weight of 512.46 g/mol. Its IUPAC name is [(3S,4R,5R)-4-iodo-2-methoxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-diphenylsilane.
| Compound Name | [(3S,4R,5R)-4-iodo-2-methoxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 173074815 |
| Molecular Formula | C22H29IO4Si |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | [(3S,4R,5R)-4-iodo-2-methoxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-3-yl]oxy-diphenylsilane |
| SMILES | COC1O[C@H](COC(C)(C)C)[C@@H](I)[C@H]1O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29IO4Si/c1-22(2,3)25-15-18-19(23)20(21(24-4)26-18)27-28(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18-21,28H,15H2,1-4H3/t18-,19-,20-,21?/m1/s1 |
| InChIKey | LKQALQLQZLKWFJ-YJUWBKPTSA-N |
| XLogP | 2.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|