About 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide
6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide (PubChem CID 173078931) has the molecular formula C10H8FIN2S
and a molecular weight of 334.16 g/mol. Its IUPAC name is 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide.
Molecular Properties
| Compound Name | 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide |
| PubChem CID | 173078931 |
| Molecular Formula | C10H8FIN2S |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide |
| SMILES | Cc1csc2nc3cc(F)ccc3n12.I |
| InChI | InChI=1S/C10H7FN2S.HI/c1-6-5-14-10-12-8-4-7(11)2-3-9(8)13(6)10;/h2-5H,1H3;1H |
| InChIKey | FIWBJMSGHVKBGK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide?
The IUPAC name of 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide (CID 173078931) is 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide.
What is the SMILES notation for 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide?
The canonical SMILES for 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide is Cc1csc2nc3cc(F)ccc3n12.I.
What is the InChIKey of 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide?
The InChIKey is FIWBJMSGHVKBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2S.HI/c1-6-5-14-10-12-8-4-7(11)2-3-9(8)13(6)10;/h2-5H,1H3;1H.
What are the key properties of 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide?
6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide has a molecular weight of 334.16 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide is sourced from PubChem (CID 173078931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).