C10H8FIN2S — CID 173078931
6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide (PubChem CID 173078931) has the molecular formula C10H8FIN2S and a molecular weight of 334.16 g/mol. Its IUPAC name is 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide.
| Compound Name | 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide |
|---|---|
| PubChem CID | 173078931 |
| Molecular Formula | C10H8FIN2S |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 6-fluoro-1-methyl-[1,3]thiazolo[3,2-a]benzimidazole;hydroiodide |
| SMILES | Cc1csc2nc3cc(F)ccc3n12.I |
| InChI | InChI=1S/C10H7FN2S.HI/c1-6-5-14-10-12-8-4-7(11)2-3-9(8)13(6)10;/h2-5H,1H3;1H |
| InChIKey | FIWBJMSGHVKBGK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|