C10H22F3N3O3S — CID 173080792
trifluoromethanesulfonic acid;2-(2,3,3-trimethylpentan-2-yl)guanidine (PubChem CID 173080792) has the molecular formula C10H22F3N3O3S and a molecular weight of 321.37 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;2-(2,3,3-trimethylpentan-2-yl)guanidine.
| Compound Name | trifluoromethanesulfonic acid;2-(2,3,3-trimethylpentan-2-yl)guanidine |
|---|---|
| PubChem CID | 173080792 |
| Molecular Formula | C10H22F3N3O3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | trifluoromethanesulfonic acid;2-(2,3,3-trimethylpentan-2-yl)guanidine |
| SMILES | CCC(C)(C)C(C)(C)N=C(N)N.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H21N3.CHF3O3S/c1-6-8(2,3)9(4,5)12-7(10)11;2-1(3,4)8(5,6)7/h6H2,1-5H3,(H4,10,11,12);(H,5,6,7) |
| InChIKey | IZSIVMNZTRDPQO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|