C18H26Hf-2 — CID 173082217
hafnium;bis(2-methyl-3-propylcyclopenta-1,3-diene) (PubChem CID 173082217) has the molecular formula C18H26Hf-2 and a molecular weight of 420.90 g/mol. Its IUPAC name is hafnium;bis(2-methyl-3-propylcyclopenta-1,3-diene).
| Compound Name | hafnium;bis(2-methyl-3-propylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 173082217 |
| Molecular Formula | C18H26Hf-2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | hafnium;bis(2-methyl-3-propylcyclopenta-1,3-diene) |
| SMILES | CCCC1=CC[C-]=C1C.CCCC1=CC[C-]=C1C.[Hf] |
| InChI | InChI=1S/2C9H13.Hf/c2*1-3-5-9-7-4-6-8(9)2;/h2*7H,3-5H2,1-2H3;/q2*-1; |
| InChIKey | SDJYWIKSGPQCIB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|