C9H15Cl2Ti- — CID 174634216
2,3-diethylcyclopenta-1,3-diene;titanium;dihydrochloride (PubChem CID 174634216) has the molecular formula C9H15Cl2Ti- and a molecular weight of 241.99 g/mol. Its IUPAC name is 2,3-diethylcyclopenta-1,3-diene;titanium;dihydrochloride.
| Compound Name | 2,3-diethylcyclopenta-1,3-diene;titanium;dihydrochloride |
|---|---|
| PubChem CID | 174634216 |
| Molecular Formula | C9H15Cl2Ti- |
| Molecular Weight | 241.99 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 2,3-diethylcyclopenta-1,3-diene;titanium;dihydrochloride |
| SMILES | CCC1=[C-]CC=C1CC.Cl.Cl.[Ti] |
| InChI | InChI=1S/C9H13.2ClH.Ti/c1-3-8-6-5-7-9(8)4-2;;;/h6H,3-5H2,1-2H3;2*1H;/q-1;;; |
| InChIKey | MANVULVRMQHRLY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.99 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|