C21H19N5O5S3 — CID 17308347
N-(4-methylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 17308347) has the molecular formula C21H19N5O5S3 and a molecular weight of 517.61 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(4-methylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17308347 |
| Molecular Formula | C21H19N5O5S3 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | N-(4-methylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCSc2nnc(NC(=O)CN3C(=O)c4ccccc4S3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C21H19N5O5S3/c1-13-6-8-14(9-7-13)22-17(27)10-11-32-21-25-24-20(33-21)23-18(28)12-26-19(29)15-4-2-3-5-16(15)34(26,30)31/h2-9H,10-12H2,1H3,(H,22,27)(H,23,24,28) |
| InChIKey | PBSNUTXEGNJGFV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|