C20H15Cl2N5O5S3 — CID 17308348
N-(3,4-dichlorophenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 17308348) has the molecular formula C20H15Cl2N5O5S3 and a molecular weight of 572.48 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17308348 |
| Molecular Formula | C20H15Cl2N5O5S3 |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 570.96 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | O=C(CCSc1nnc(NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)s1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2N5O5S3/c21-13-6-5-11(9-14(13)22)23-16(28)7-8-33-20-26-25-19(34-20)24-17(29)10-27-18(30)12-3-1-2-4-15(12)35(27,31)32/h1-6,9H,7-8,10H2,(H,23,28)(H,24,25,29) |
| InChIKey | CGHUBEGSQUUYSJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|