C22H21N5O5S3 — CID 17344257
N-(2,5-dimethylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 17344257) has the molecular formula C22H21N5O5S3 and a molecular weight of 531.64 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17344257 |
| Molecular Formula | C22H21N5O5S3 |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-[[5-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCSc2nnc(NC(=O)CN3C(=O)c4ccccc4S3(=O)=O)s2)c1 |
| InChI | InChI=1S/C22H21N5O5S3/c1-13-7-8-14(2)16(11-13)23-18(28)9-10-33-22-26-25-21(34-22)24-19(29)12-27-20(30)15-5-3-4-6-17(15)35(27,31)32/h3-8,11H,9-10,12H2,1-2H3,(H,23,28)(H,24,25,29) |
| InChIKey | ROOSESSUELNLBC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|