About CID 173085004
CID 173085004 (PubChem CID 173085004) has the molecular formula C8H9As
and a molecular weight of 180.08 g/mol.
Molecular Properties
| Compound Name | CID 173085004 |
| PubChem CID | 173085004 |
| Molecular Formula | C8H9As |
| Molecular Weight | 180.08 g/mol |
| Exact Mass | 179.99 |
| IUPAC Name | — |
| SMILES | CCc1ccccc1[As] |
| InChI | InChI=1S/C8H9As/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 |
| InChIKey | QUZZCNAPLHMYFT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.08 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173085004 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173085004?
The IUPAC name of CID 173085004 (CID 173085004) is not available.
What is the SMILES notation for CID 173085004?
The canonical SMILES for CID 173085004 is CCc1ccccc1[As].
What is the InChIKey of CID 173085004?
The InChIKey is QUZZCNAPLHMYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9As/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3.
What are the key properties of CID 173085004?
CID 173085004 has a molecular weight of 180.08 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173085004 is sourced from PubChem (CID 173085004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).