C28H29N3O5S3 — CID 173086950
cyclohexylmethyl 3,3-bis[(4-nitrophenyl)sulfanyl]-N-phenylsulfanylpropanimidate (PubChem CID 173086950) has the molecular formula C28H29N3O5S3 and a molecular weight of 583.76 g/mol. Its IUPAC name is cyclohexylmethyl 3,3-bis[(4-nitrophenyl)sulfanyl]-N-phenylsulfanylpropanimidate.
| Compound Name | cyclohexylmethyl 3,3-bis[(4-nitrophenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
|---|---|
| PubChem CID | 173086950 |
| Molecular Formula | C28H29N3O5S3 |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | cyclohexylmethyl 3,3-bis[(4-nitrophenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
| SMILES | O=[N+]([O-])c1ccc(SC(CC(=NSc2ccccc2)OCC2CCCCC2)Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H29N3O5S3/c32-30(33)22-11-15-24(16-12-22)37-28(38-25-17-13-23(14-18-25)31(34)35)19-27(29-39-26-9-5-2-6-10-26)36-20-21-7-3-1-4-8-21/h2,5-6,9-18,21,28H,1,3-4,7-8,19-20H2 |
| InChIKey | LGBBMBPVICALKD-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 107.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|