C29H27NOS3 — CID 173087392
phenyl 3,3-bis[(4-methylphenyl)sulfanyl]-N-phenylsulfanylpropanimidate (PubChem CID 173087392) has the molecular formula C29H27NOS3 and a molecular weight of 501.74 g/mol. Its IUPAC name is phenyl 3,3-bis[(4-methylphenyl)sulfanyl]-N-phenylsulfanylpropanimidate.
| Compound Name | phenyl 3,3-bis[(4-methylphenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
|---|---|
| PubChem CID | 173087392 |
| Molecular Formula | C29H27NOS3 |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | phenyl 3,3-bis[(4-methylphenyl)sulfanyl]-N-phenylsulfanylpropanimidate |
| SMILES | Cc1ccc(SC(CC(=NSc2ccccc2)Oc2ccccc2)Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H27NOS3/c1-22-13-17-25(18-14-22)32-29(33-26-19-15-23(2)16-20-26)21-28(31-24-9-5-3-6-10-24)30-34-27-11-7-4-8-12-27/h3-20,29H,21H2,1-2H3 |
| InChIKey | KNKURFSGACSOJS-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|