C35H26F5NOS2 — CID 25207205
[4-(trifluoromethyl)phenyl] 3,3-bis[(4-fluorophenyl)sulfanyl]-N-[4-(2-methylphenyl)phenyl]propanimidate (PubChem CID 25207205) has the molecular formula C35H26F5NOS2 and a molecular weight of 635.72 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 3,3-bis[(4-fluorophenyl)sulfanyl]-N-[4-(2-methylphenyl)phenyl]propanimidate.
| Compound Name | [4-(trifluoromethyl)phenyl] 3,3-bis[(4-fluorophenyl)sulfanyl]-N-[4-(2-methylphenyl)phenyl]propanimidate |
|---|---|
| PubChem CID | 25207205 |
| Molecular Formula | C35H26F5NOS2 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 3,3-bis[(4-fluorophenyl)sulfanyl]-N-[4-(2-methylphenyl)phenyl]propanimidate |
| SMILES | Cc1ccccc1-c1ccc(/N=C(/CC(Sc2ccc(F)cc2)Sc2ccc(F)cc2)Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C35H26F5NOS2/c1-23-4-2-3-5-32(23)24-6-14-28(15-7-24)41-33(42-29-16-8-25(9-17-29)35(38,39)40)22-34(43-30-18-10-26(36)11-19-30)44-31-20-12-27(37)13-21-31/h2-21,34H,22H2,1H3/b41-33- |
| InChIKey | YMSCRUICCVROBJ-AZOIZXLMSA-N |
| XLogP | 11.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|