About sodium;hydride;phenylmethaneselenol
sodium;hydride;phenylmethaneselenol (PubChem CID 173088869) has the molecular formula C7H9NaSe
and a molecular weight of 195.10 g/mol. Its IUPAC name is sodium;hydride;phenylmethaneselenol.
Molecular Properties
| Compound Name | sodium;hydride;phenylmethaneselenol |
| PubChem CID | 173088869 |
| Molecular Formula | C7H9NaSe |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | sodium;hydride;phenylmethaneselenol |
| SMILES | [H-].[Na+].[SeH]Cc1ccccc1 |
| InChI | InChI=1S/C7H8Se.Na.H/c8-6-7-4-2-1-3-5-7;;/h1-5,8H,6H2;;/q;+1;-1 |
| InChIKey | CTASNIYQYZAKBX-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenylmethaneselenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenylmethaneselenol?
The IUPAC name of sodium;hydride;phenylmethaneselenol (CID 173088869) is sodium;hydride;phenylmethaneselenol.
What is the SMILES notation for sodium;hydride;phenylmethaneselenol?
The canonical SMILES for sodium;hydride;phenylmethaneselenol is [H-].[Na+].[SeH]Cc1ccccc1.
What is the InChIKey of sodium;hydride;phenylmethaneselenol?
The InChIKey is CTASNIYQYZAKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Se.Na.H/c8-6-7-4-2-1-3-5-7;;/h1-5,8H,6H2;;/q;+1;-1.
What are the key properties of sodium;hydride;phenylmethaneselenol?
sodium;hydride;phenylmethaneselenol has a molecular weight of 195.10 g/mol, XLogP of -1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenylmethaneselenol is sourced from PubChem (CID 173088869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).