About sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene
sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene (PubChem CID 173389810) has the molecular formula C16H19NaSe
and a molecular weight of 313.28 g/mol. Its IUPAC name is sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene.
Molecular Properties
| Compound Name | sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene |
| PubChem CID | 173389810 |
| Molecular Formula | C16H19NaSe |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene |
| SMILES | [H-].[Na+].c1ccc(CC[Se]CCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18Se.Na.H/c1-3-7-15(8-4-1)11-13-17-14-12-16-9-5-2-6-10-16;;/h1-10H,11-14H2;;/q;+1;-1 |
| InChIKey | BAJMILBWPIRVQE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene?
The IUPAC name of sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene (CID 173389810) is sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene.
What is the SMILES notation for sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene?
The canonical SMILES for sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene is [H-].[Na+].c1ccc(CC[Se]CCc2ccccc2)cc1.
What is the InChIKey of sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene?
The InChIKey is BAJMILBWPIRVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Se.Na.H/c1-3-7-15(8-4-1)11-13-17-14-12-16-9-5-2-6-10-16;;/h1-10H,11-14H2;;/q;+1;-1.
What are the key properties of sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene?
sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene has a molecular weight of 313.28 g/mol, XLogP of 1.13, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-(2-phenylethylselanyl)ethylbenzene is sourced from PubChem (CID 173389810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).