C26H28Si2 — CID 173101546
[2,2-bis(ethenyl)-1-phenyl-1-silylbut-3-enyl]-diphenylsilane (PubChem CID 173101546) has the molecular formula C26H28Si2 and a molecular weight of 396.68 g/mol. Its IUPAC name is [2,2-bis(ethenyl)-1-phenyl-1-silylbut-3-enyl]-diphenylsilane.
| Compound Name | [2,2-bis(ethenyl)-1-phenyl-1-silylbut-3-enyl]-diphenylsilane |
|---|---|
| PubChem CID | 173101546 |
| Molecular Formula | C26H28Si2 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2,2-bis(ethenyl)-1-phenyl-1-silylbut-3-enyl]-diphenylsilane |
| SMILES | C=CC(C=C)(C=C)C([SiH3])(c1ccccc1)[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28Si2/c1-4-25(5-2,6-3)26(27,22-16-10-7-11-17-22)28(23-18-12-8-13-19-23)24-20-14-9-15-21-24/h4-21,28H,1-3H2,27H3 |
| InChIKey | GADGCDSNZYYITM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|