C18H15BrFNO3 — CID 173103255
ethyl 3-(2-bromophenyl)-2-(4-fluorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate (PubChem CID 173103255) has the molecular formula C18H15BrFNO3 and a molecular weight of 392.22 g/mol. Its IUPAC name is ethyl 3-(2-bromophenyl)-2-(4-fluorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(2-bromophenyl)-2-(4-fluorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 173103255 |
| Molecular Formula | C18H15BrFNO3 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | ethyl 3-(2-bromophenyl)-2-(4-fluorobenzenecarboximidoyl)-3-hydroxyprop-2-enoate |
| SMILES | [H]/N=C(/C(C(=O)OCC)=C(O)c1ccccc1Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15BrFNO3/c1-2-24-18(23)15(16(21)11-7-9-12(20)10-8-11)17(22)13-5-3-4-6-14(13)19/h3-10,21-22H,2H2,1H3/b17-15?,21-16+ |
| InChIKey | GUUFYRYPDRWASF-ALNRNORLSA-N |
| XLogP | 4.49 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|