C25H31FO3 — CID 173104089
tert-butyl [5-[(2R)-6-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl]-2-fluorophenyl] carbonate (PubChem CID 173104089) has the molecular formula C25H31FO3 and a molecular weight of 398.52 g/mol. Its IUPAC name is tert-butyl [5-[(2R)-6-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl]-2-fluorophenyl] carbonate.
| Compound Name | tert-butyl [5-[(2R)-6-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl]-2-fluorophenyl] carbonate |
|---|---|
| PubChem CID | 173104089 |
| Molecular Formula | C25H31FO3 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | tert-butyl [5-[(2R)-6-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl]-2-fluorophenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1cc([C@@H]2CCc3cc(C(C)(C)C)ccc3C2)ccc1F |
| InChI | InChI=1S/C25H31FO3/c1-24(2,3)20-11-9-17-13-16(7-8-18(17)14-20)19-10-12-21(26)22(15-19)28-23(27)29-25(4,5)6/h9-12,14-16H,7-8,13H2,1-6H3/t16-/m1/s1 |
| InChIKey | HIVMKEBVSUVBOL-MRXNPFEDSA-N |
| XLogP | 6.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|