About CID 173106784
CID 173106784 (PubChem CID 173106784) has the molecular formula C12H23AlBr
and a molecular weight of 274.20 g/mol.
Molecular Properties
| Compound Name | CID 173106784 |
| PubChem CID | 173106784 |
| Molecular Formula | C12H23AlBr |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | — |
| SMILES | Br.C1CCC([Al]C2CCCCC2)CC1 |
| InChI | InChI=1S/2C6H11.Al.BrH/c2*1-2-4-6-5-3-1;;/h2*1H,2-6H2;;1H |
| InChIKey | AHLNPRPSQWRSTL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173106784 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173106784?
The IUPAC name of CID 173106784 (CID 173106784) is not available.
What is the SMILES notation for CID 173106784?
The canonical SMILES for CID 173106784 is Br.C1CCC([Al]C2CCCCC2)CC1.
What is the InChIKey of CID 173106784?
The InChIKey is AHLNPRPSQWRSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11.Al.BrH/c2*1-2-4-6-5-3-1;;/h2*1H,2-6H2;;1H.
What are the key properties of CID 173106784?
CID 173106784 has a molecular weight of 274.20 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173106784 is sourced from PubChem (CID 173106784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).