C10H14N4S — CID 173107987
N-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]methanethioamide (PubChem CID 173107987) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]methanethioamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]methanethioamide |
|---|---|
| PubChem CID | 173107987 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]methanethioamide |
| SMILES | CN(C)c1ccc(C=NNNC=S)cc1 |
| InChI | InChI=1S/C10H14N4S/c1-14(2)10-5-3-9(4-6-10)7-11-13-12-8-15/h3-8,13H,1-2H3,(H,12,15) |
| InChIKey | NTYUFMGOSIBQEZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|