About 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one
5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one (PubChem CID 173108297) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one.
Molecular Properties
| Compound Name | 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one |
| PubChem CID | 173108297 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one |
| SMILES | COc1cc(C=CC2=NC(c3ccccc3)=NC2=O)cc(OC)c1O |
| InChI | InChI=1S/C19H16N2O4/c1-24-15-10-12(11-16(25-2)17(15)22)8-9-14-19(23)21-18(20-14)13-6-4-3-5-7-13/h3-11,22H,1-2H3 |
| InChIKey | RLWHSJAFRLFUIE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one?
The IUPAC name of 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one (CID 173108297) is 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one.
What is the SMILES notation for 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one?
The canonical SMILES for 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one is COc1cc(C=CC2=NC(c3ccccc3)=NC2=O)cc(OC)c1O.
What is the InChIKey of 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one?
The InChIKey is RLWHSJAFRLFUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c1-24-15-10-12(11-16(25-2)17(15)22)8-9-14-19(23)21-18(20-14)13-6-4-3-5-7-13/h3-11,22H,1-2H3.
What are the key properties of 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one?
5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one has a molecular weight of 336.35 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-phenylimidazol-4-one is sourced from PubChem (CID 173108297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).