C18H30AsN3O3 — CID 173108449
tert-butyl 2,6-diethyl-4-(5-hydroxypyrimidin-2-yl)arsanylpiperidine-1-carboxylate (PubChem CID 173108449) has the molecular formula C18H30AsN3O3 and a molecular weight of 411.38 g/mol. Its IUPAC name is tert-butyl 2,6-diethyl-4-(5-hydroxypyrimidin-2-yl)arsanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2,6-diethyl-4-(5-hydroxypyrimidin-2-yl)arsanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 173108449 |
| Molecular Formula | C18H30AsN3O3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | tert-butyl 2,6-diethyl-4-(5-hydroxypyrimidin-2-yl)arsanylpiperidine-1-carboxylate |
| SMILES | CCC1CC([AsH]c2ncc(O)cn2)CC(CC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30AsN3O3/c1-6-13-8-12(19-16-20-10-15(23)11-21-16)9-14(7-2)22(13)17(24)25-18(3,4)5/h10-14,19,23H,6-9H2,1-5H3 |
| InChIKey | XZFREJISZPQMFC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|