C12H20N2O2S — CID 173118176
N,N',N'-triethylbenzenesulfonohydrazide (PubChem CID 173118176) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N,N',N'-triethylbenzenesulfonohydrazide.
| Compound Name | N,N',N'-triethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 173118176 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N,N',N'-triethylbenzenesulfonohydrazide |
| SMILES | CCN(CC)N(CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-4-13(5-2)14(6-3)17(15,16)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | PBAXRPZLDQDKMY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|