C18H18ClFN2O3 — CID 173118647
3-[3-[4-(3-chloro-4-fluorophenyl)phenyl]propanoylamino]-2-hydroxypropanamide (PubChem CID 173118647) has the molecular formula C18H18ClFN2O3 and a molecular weight of 364.80 g/mol. Its IUPAC name is 3-[3-[4-(3-chloro-4-fluorophenyl)phenyl]propanoylamino]-2-hydroxypropanamide.
| Compound Name | 3-[3-[4-(3-chloro-4-fluorophenyl)phenyl]propanoylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 173118647 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-[3-[4-(3-chloro-4-fluorophenyl)phenyl]propanoylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC(=O)CCc1ccc(-c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H18ClFN2O3/c19-14-9-13(6-7-15(14)20)12-4-1-11(2-5-12)3-8-17(24)22-10-16(23)18(21)25/h1-2,4-7,9,16,23H,3,8,10H2,(H2,21,25)(H,22,24) |
| InChIKey | XXVACPRWCKBANV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |