C21H25N3O3 — CID 173118973
butyl N-[5-phenyl-4-(pyrrolidine-1-carbonyl)-3-pyridinyl]carbamate (PubChem CID 173118973) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is butyl N-[5-phenyl-4-(pyrrolidine-1-carbonyl)-3-pyridinyl]carbamate.
| Compound Name | butyl N-[5-phenyl-4-(pyrrolidine-1-carbonyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 173118973 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | butyl N-[5-phenyl-4-(pyrrolidine-1-carbonyl)-3-pyridinyl]carbamate |
| SMILES | CCCCOC(=O)Nc1cncc(-c2ccccc2)c1C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H25N3O3/c1-2-3-13-27-21(26)23-18-15-22-14-17(16-9-5-4-6-10-16)19(18)20(25)24-11-7-8-12-24/h4-6,9-10,14-15H,2-3,7-8,11-13H2,1H3,(H,23,26) |
| InChIKey | MAYOKAYYZHFOHV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|