C14H19N5O2 — CID 173120186
2-(1-benzyltetrazol-5-yl)-2-butoxyacetamide (PubChem CID 173120186) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)-2-butoxyacetamide.
| Compound Name | 2-(1-benzyltetrazol-5-yl)-2-butoxyacetamide |
|---|---|
| PubChem CID | 173120186 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)-2-butoxyacetamide |
| SMILES | CCCCOC(C(N)=O)c1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C14H19N5O2/c1-2-3-9-21-12(13(15)20)14-16-17-18-19(14)10-11-7-5-4-6-8-11/h4-8,12H,2-3,9-10H2,1H3,(H2,15,20) |
| InChIKey | APZNXXLUDOMWRI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|