About 5-fluoropent-4-enoic acid
5-fluoropent-4-enoic acid (PubChem CID 173120467) has the molecular formula C5H7FO2
and a molecular weight of 118.11 g/mol. Its IUPAC name is 5-fluoropent-4-enoic acid.
Molecular Properties
| Compound Name | 5-fluoropent-4-enoic acid |
| PubChem CID | 173120467 |
| Molecular Formula | C5H7FO2 |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | 5-fluoropent-4-enoic acid |
| SMILES | O=C(O)CCC=CF |
| InChI | InChI=1S/C5H7FO2/c6-4-2-1-3-5(7)8/h2,4H,1,3H2,(H,7,8) |
| InChIKey | MSAFFDOJKDGGPW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoropent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoropent-4-enoic acid?
The IUPAC name of 5-fluoropent-4-enoic acid (CID 173120467) is 5-fluoropent-4-enoic acid.
What is the SMILES notation for 5-fluoropent-4-enoic acid?
The canonical SMILES for 5-fluoropent-4-enoic acid is O=C(O)CCC=CF.
What is the InChIKey of 5-fluoropent-4-enoic acid?
The InChIKey is MSAFFDOJKDGGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FO2/c6-4-2-1-3-5(7)8/h2,4H,1,3H2,(H,7,8).
What are the key properties of 5-fluoropent-4-enoic acid?
5-fluoropent-4-enoic acid has a molecular weight of 118.11 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoropent-4-enoic acid is sourced from PubChem (CID 173120467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).