C22H38N2O5 — CID 173124357
[3-[3-(3-but-2-enoyloxy-2,2-dimethylpropyl)-5-methyl-3-oxidoimidazolidin-3-ium-1-yl]-2,2-dimethylpropyl] but-2-enoate (PubChem CID 173124357) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is [3-[3-(3-but-2-enoyloxy-2,2-dimethylpropyl)-5-methyl-3-oxidoimidazolidin-3-ium-1-yl]-2,2-dimethylpropyl] but-2-enoate.
| Compound Name | [3-[3-(3-but-2-enoyloxy-2,2-dimethylpropyl)-5-methyl-3-oxidoimidazolidin-3-ium-1-yl]-2,2-dimethylpropyl] but-2-enoate |
|---|---|
| PubChem CID | 173124357 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [3-[3-(3-but-2-enoyloxy-2,2-dimethylpropyl)-5-methyl-3-oxidoimidazolidin-3-ium-1-yl]-2,2-dimethylpropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(C)(C)CN1C[N+]([O-])(CC(C)(C)COC(=O)C=CC)CC1C |
| InChI | InChI=1S/C22H38N2O5/c1-8-10-19(25)28-15-21(4,5)13-23-17-24(27,12-18(23)3)14-22(6,7)16-29-20(26)11-9-2/h8-11,18H,12-17H2,1-7H3 |
| InChIKey | RIENQLAUUFTXFK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|