C22H42O6Si2 — CID 173125357
benzyl(diethoxy)silane;diethoxy-[4-(oxiran-2-ylmethoxy)butyl]silane (PubChem CID 173125357) has the molecular formula C22H42O6Si2 and a molecular weight of 458.74 g/mol. Its IUPAC name is benzyl(diethoxy)silane;diethoxy-[4-(oxiran-2-ylmethoxy)butyl]silane.
| Compound Name | benzyl(diethoxy)silane;diethoxy-[4-(oxiran-2-ylmethoxy)butyl]silane |
|---|---|
| PubChem CID | 173125357 |
| Molecular Formula | C22H42O6Si2 |
| Molecular Weight | 458.74 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | benzyl(diethoxy)silane;diethoxy-[4-(oxiran-2-ylmethoxy)butyl]silane |
| SMILES | CCO[SiH](CCCCOCC1CO1)OCC.CCO[SiH](Cc1ccccc1)OCC |
| InChI | InChI=1S/C11H24O4Si.C11H18O2Si/c1-3-14-16(15-4-2)8-6-5-7-12-9-11-10-13-11;1-3-12-14(13-4-2)10-11-8-6-5-7-9-11/h11,16H,3-10H2,1-2H3;5-9,14H,3-4,10H2,1-2H3 |
| InChIKey | NQQJSIZYQBORDG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|