C6H15NO7S — CID 173125507
2-[2-hydroxyethyl(methyl)amino]acetaldehyde;methoxy hydrogen sulfate (PubChem CID 173125507) has the molecular formula C6H15NO7S and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(methyl)amino]acetaldehyde;methoxy hydrogen sulfate.
| Compound Name | 2-[2-hydroxyethyl(methyl)amino]acetaldehyde;methoxy hydrogen sulfate |
|---|---|
| PubChem CID | 173125507 |
| Molecular Formula | C6H15NO7S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[2-hydroxyethyl(methyl)amino]acetaldehyde;methoxy hydrogen sulfate |
| SMILES | CN(CC=O)CCO.COOS(=O)(=O)O |
| InChI | InChI=1S/C5H11NO2.CH4O5S/c1-6(2-4-7)3-5-8;1-5-6-7(2,3)4/h4,8H,2-3,5H2,1H3;1H3,(H,2,3,4) |
| InChIKey | KRNFWLYHSHWDKO-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|