C3H9NO10S2 — CID 22602657
N,N-dimethylformamide;sulfoperoxy hydrogen sulfate (PubChem CID 22602657) has the molecular formula C3H9NO10S2 and a molecular weight of 283.24 g/mol. Its IUPAC name is N,N-dimethylformamide;sulfoperoxy hydrogen sulfate.
| Compound Name | N,N-dimethylformamide;sulfoperoxy hydrogen sulfate |
|---|---|
| PubChem CID | 22602657 |
| Molecular Formula | C3H9NO10S2 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | N,N-dimethylformamide;sulfoperoxy hydrogen sulfate |
| SMILES | CN(C)C=O.O=S(=O)(O)OOOS(=O)(=O)O |
| InChI | InChI=1S/C3H7NO.H2O9S2/c1-4(2)3-5;1-10(2,3)8-7-9-11(4,5)6/h3H,1-2H3;(H,1,2,3)(H,4,5,6) |
| InChIKey | ITODONSTYFKJAB-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|