C12H30AlN2 — CID 173126602
CID 173126602 (PubChem CID 173126602) has the molecular formula C12H30AlN2 and a molecular weight of 229.37 g/mol.
| Compound Name | CID 173126602 |
|---|---|
| PubChem CID | 173126602 |
| Molecular Formula | C12H30AlN2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | — |
| SMILES | CC(C)[Al]C(C)C.CCN(C)CCNC |
| InChI | InChI=1S/C6H16N2.2C3H7.Al/c1-4-8(3)6-5-7-2;2*1-3-2;/h7H,4-6H2,1-3H3;2*3H,1-2H3; |
| InChIKey | JCBYIJRRUFHNKR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |