About 4-butyl-5-methyl-2,3-dihydroselenophene
4-butyl-5-methyl-2,3-dihydroselenophene (PubChem CID 173132021) has the molecular formula C9H16Se
and a molecular weight of 203.19 g/mol. Its IUPAC name is 4-butyl-5-methyl-2,3-dihydroselenophene.
Molecular Properties
| Compound Name | 4-butyl-5-methyl-2,3-dihydroselenophene |
| PubChem CID | 173132021 |
| Molecular Formula | C9H16Se |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 4-butyl-5-methyl-2,3-dihydroselenophene |
| SMILES | CCCCC1=C(C)[Se]CC1 |
| InChI | InChI=1S/C9H16Se/c1-3-4-5-9-6-7-10-8(9)2/h3-7H2,1-2H3 |
| InChIKey | VBKMCVASYKGLMZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-5-methyl-2,3-dihydroselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-methyl-2,3-dihydroselenophene?
The IUPAC name of 4-butyl-5-methyl-2,3-dihydroselenophene (CID 173132021) is 4-butyl-5-methyl-2,3-dihydroselenophene.
What is the SMILES notation for 4-butyl-5-methyl-2,3-dihydroselenophene?
The canonical SMILES for 4-butyl-5-methyl-2,3-dihydroselenophene is CCCCC1=C(C)[Se]CC1.
What is the InChIKey of 4-butyl-5-methyl-2,3-dihydroselenophene?
The InChIKey is VBKMCVASYKGLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16Se/c1-3-4-5-9-6-7-10-8(9)2/h3-7H2,1-2H3.
What are the key properties of 4-butyl-5-methyl-2,3-dihydroselenophene?
4-butyl-5-methyl-2,3-dihydroselenophene has a molecular weight of 203.19 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-methyl-2,3-dihydroselenophene is sourced from PubChem (CID 173132021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).