About (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane
(2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane (PubChem CID 173133216) has the molecular formula C24H22OSn
and a molecular weight of 445.15 g/mol. Its IUPAC name is (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane.
Molecular Properties
| Compound Name | (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane |
| PubChem CID | 173133216 |
| Molecular Formula | C24H22OSn |
| Molecular Weight | 445.15 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane |
| SMILES | O=C([SnH])C(Cc1ccccc1)=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H21O.Sn.H/c25-19-24(18-22-14-8-3-9-15-22)23(16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21;;/h1-15H,16-18H2;; |
| InChIKey | DKNBFPWQFKHAAK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane?
The IUPAC name of (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane (CID 173133216) is (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane.
What is the SMILES notation for (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane?
The canonical SMILES for (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane is O=C([SnH])C(Cc1ccccc1)=C(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane?
The InChIKey is DKNBFPWQFKHAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21O.Sn.H/c25-19-24(18-22-14-8-3-9-15-22)23(16-20-10-4-1-5-11-20)17-21-12-6-2-7-13-21;;/h1-15H,16-18H2;;.
What are the key properties of (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane?
(2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane has a molecular weight of 445.15 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dibenzyl-4-phenylbut-2-enoyl)-λ2-stannane is sourced from PubChem (CID 173133216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).