C19H30O3 — CID 173133739
[(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2-methylpropanoate (PubChem CID 173133739) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2-methylpropanoate.
| Compound Name | [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 173133739 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 2-methylpropanoate |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@]2(O)C[C@@H](OC(=O)C(C)C)C(C)=C[C@@H]12 |
| InChI | InChI=1S/C19H30O3/c1-11(2)15-8-7-14(6)19(21)10-17(13(5)9-16(15)19)22-18(20)12(3)4/h9,12,14-17,21H,1,7-8,10H2,2-6H3/t14-,15+,16+,17-,19-/m1/s1 |
| InChIKey | NSDJMFAZMMVCKV-DIKXUDHVSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|