C19H30O4 — CID 173134316
[(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] prop-1-en-2-yl carbonate (PubChem CID 173134316) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] prop-1-en-2-yl carbonate.
| Compound Name | [(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] prop-1-en-2-yl carbonate |
|---|---|
| PubChem CID | 173134316 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [(2R,4aS,5S,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-propan-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] prop-1-en-2-yl carbonate |
| SMILES | C=C(C)OC(=O)O[C@@H]1C[C@@]2(O)[C@H](C)CC[C@@H](C(C)C)[C@H]2C=C1C |
| InChI | InChI=1S/C19H30O4/c1-11(2)15-8-7-14(6)19(21)10-17(13(5)9-16(15)19)23-18(20)22-12(3)4/h9,11,14-17,21H,3,7-8,10H2,1-2,4-6H3/t14-,15+,16-,17-,19-/m1/s1 |
| InChIKey | CPQOZZCDHXJEFA-FSNPWBFUSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|