C17H26F2O3 — CID 173134205
[(2R,4aS,5R,8R,8aR)-5-(1,1-difluoropropan-2-yl)-8a-hydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 173134205) has the molecular formula C17H26F2O3 and a molecular weight of 316.39 g/mol. Its IUPAC name is [(2R,4aS,5R,8R,8aR)-5-(1,1-difluoropropan-2-yl)-8a-hydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,4aS,5R,8R,8aR)-5-(1,1-difluoropropan-2-yl)-8a-hydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 173134205 |
| Molecular Formula | C17H26F2O3 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(2R,4aS,5R,8R,8aR)-5-(1,1-difluoropropan-2-yl)-8a-hydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(O)[C@H](C)CC[C@@H](C(C)C(F)F)[C@H]2C=C1C |
| InChI | InChI=1S/C17H26F2O3/c1-9-7-14-13(11(3)16(18)19)6-5-10(2)17(14,21)8-15(9)22-12(4)20/h7,10-11,13-16,21H,5-6,8H2,1-4H3/t10-,11?,13+,14-,15-,17-/m1/s1 |
| InChIKey | GQOIPKCJSJSFJQ-IXOWYEFMSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|